C7H14N2O — CID 115964722
1,3-dimethyl-1-(2-methylprop-2-enyl)urea (PubChem CID 115964722) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 1,3-dimethyl-1-(2-methylprop-2-enyl)urea.
| Compound Name | 1,3-dimethyl-1-(2-methylprop-2-enyl)urea |
|---|---|
| PubChem CID | 115964722 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 1,3-dimethyl-1-(2-methylprop-2-enyl)urea |
| SMILES | C=C(C)CN(C)C(=O)NC |
| InChI | InChI=1S/C7H14N2O/c1-6(2)5-9(4)7(10)8-3/h1,5H2,2-4H3,(H,8,10) |
| InChIKey | NFESORMTSMLLPS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|