C8H17N3O2 — CID 115575214
2-[methyl(methylcarbamoyl)amino]-N-propan-2-ylacetamide (PubChem CID 115575214) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-[methyl(methylcarbamoyl)amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[methyl(methylcarbamoyl)amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 115575214 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 2-[methyl(methylcarbamoyl)amino]-N-propan-2-ylacetamide |
| SMILES | CNC(=O)N(C)CC(=O)NC(C)C |
| InChI | InChI=1S/C8H17N3O2/c1-6(2)10-7(12)5-11(4)8(13)9-3/h6H,5H2,1-4H3,(H,9,13)(H,10,12) |
| InChIKey | LRCSWSLHRORVHK-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |