C10H19BrN2O2 — CID 114328087
2-bromo-N,2-dimethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]propanamide (PubChem CID 114328087) has the molecular formula C10H19BrN2O2 and a molecular weight of 279.18 g/mol. Its IUPAC name is 2-bromo-N,2-dimethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]propanamide.
| Compound Name | 2-bromo-N,2-dimethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 114328087 |
| Molecular Formula | C10H19BrN2O2 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-bromo-N,2-dimethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]propanamide |
| SMILES | CC(C)NC(=O)CN(C)C(=O)C(C)(C)Br |
| InChI | InChI=1S/C10H19BrN2O2/c1-7(2)12-8(14)6-13(5)9(15)10(3,4)11/h7H,6H2,1-5H3,(H,12,14) |
| InChIKey | WTSOULAKFVTYFS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|