About 1-amino-3,3-dimethyl-1-prop-1-enylurea
1-amino-3,3-dimethyl-1-prop-1-enylurea (PubChem CID 151062010) has the molecular formula C6H13N3O
and a molecular weight of 143.19 g/mol. Its IUPAC name is 1-amino-3,3-dimethyl-1-prop-1-enylurea.
Molecular Properties
| Compound Name | 1-amino-3,3-dimethyl-1-prop-1-enylurea |
| PubChem CID | 151062010 |
| Molecular Formula | C6H13N3O |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 1-amino-3,3-dimethyl-1-prop-1-enylurea |
| SMILES | CC=CN(N)C(=O)N(C)C |
| InChI | InChI=1S/C6H13N3O/c1-4-5-9(7)6(10)8(2)3/h4-5H,7H2,1-3H3 |
| InChIKey | MGJCWRXUUWPGJO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3,3-dimethyl-1-prop-1-enylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3,3-dimethyl-1-prop-1-enylurea?
The IUPAC name of 1-amino-3,3-dimethyl-1-prop-1-enylurea (CID 151062010) is 1-amino-3,3-dimethyl-1-prop-1-enylurea.
What is the SMILES notation for 1-amino-3,3-dimethyl-1-prop-1-enylurea?
The canonical SMILES for 1-amino-3,3-dimethyl-1-prop-1-enylurea is CC=CN(N)C(=O)N(C)C.
What is the InChIKey of 1-amino-3,3-dimethyl-1-prop-1-enylurea?
The InChIKey is MGJCWRXUUWPGJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O/c1-4-5-9(7)6(10)8(2)3/h4-5H,7H2,1-3H3.
What are the key properties of 1-amino-3,3-dimethyl-1-prop-1-enylurea?
1-amino-3,3-dimethyl-1-prop-1-enylurea has a molecular weight of 143.19 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3,3-dimethyl-1-prop-1-enylurea is sourced from PubChem (CID 151062010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).