C6H12N2O — CID 166848992
(Z)-2-amino-N,N-dimethylbut-2-enamide (PubChem CID 166848992) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is (Z)-2-amino-N,N-dimethylbut-2-enamide.
| Compound Name | (Z)-2-amino-N,N-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 166848992 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | (Z)-2-amino-N,N-dimethylbut-2-enamide |
| SMILES | C/C=C(\N)C(=O)N(C)C |
| InChI | InChI=1S/C6H12N2O/c1-4-5(7)6(9)8(2)3/h4H,7H2,1-3H3/b5-4- |
| InChIKey | FHVUQMBJXZNCKZ-PLNGDYQASA-N |
| XLogP | -0.06 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|