C7H14N4O — CID 153382620
(E)-2-amino-4-imino-N,N-dimethyl-3-(methylamino)but-2-enamide (PubChem CID 153382620) has the molecular formula C7H14N4O and a molecular weight of 170.22 g/mol. Its IUPAC name is (E)-2-amino-4-imino-N,N-dimethyl-3-(methylamino)but-2-enamide.
| Compound Name | (E)-2-amino-4-imino-N,N-dimethyl-3-(methylamino)but-2-enamide |
|---|---|
| PubChem CID | 153382620 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | (E)-2-amino-4-imino-N,N-dimethyl-3-(methylamino)but-2-enamide |
| SMILES | [H]/N=C/C(NC)=C(\N)C(=O)N(C)C |
| InChI | InChI=1S/C7H14N4O/c1-10-5(4-8)6(9)7(12)11(2)3/h4,8,10H,9H2,1-3H3/b6-5+,8-4+ |
| InChIKey | NVAFWLBFNRERJR-PTFSRLPTSA-N |
| XLogP | -0.89 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|