C7H12N2 — CID 138510815
(2E)-1-imino-N,3-dimethylpenta-2,4-dien-2-amine (PubChem CID 138510815) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is (2E)-1-imino-N,3-dimethylpenta-2,4-dien-2-amine.
| Compound Name | (2E)-1-imino-N,3-dimethylpenta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 138510815 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (2E)-1-imino-N,3-dimethylpenta-2,4-dien-2-amine |
| SMILES | [H]/N=C/C(NC)=C(/C)C=C |
| InChI | InChI=1S/C7H12N2/c1-4-6(2)7(5-8)9-3/h4-5,8-9H,1H2,2-3H3/b7-6+,8-5+ |
| InChIKey | LFOVVGVDAKZCEY-ZCOYIIAOSA-N |
| XLogP | 1.32 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|