C7H11NO — CID 145478376
(Z)-5-imino-3,4-dimethylpent-3-en-2-one (PubChem CID 145478376) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (Z)-5-imino-3,4-dimethylpent-3-en-2-one.
| Compound Name | (Z)-5-imino-3,4-dimethylpent-3-en-2-one |
|---|---|
| PubChem CID | 145478376 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (Z)-5-imino-3,4-dimethylpent-3-en-2-one |
| SMILES | [H]/N=C/C(C)=C(/C)C(C)=O |
| InChI | InChI=1S/C7H11NO/c1-5(4-8)6(2)7(3)9/h4,8H,1-3H3/b6-5-,8-4+ |
| InChIKey | AMLJWGWIGBKSHR-QNMAEOQASA-N |
| XLogP | 1.56 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|