About 2-iminoacetic acid;hydrobromide
2-iminoacetic acid;hydrobromide (PubChem CID 175483406) has the molecular formula C2H4BrNO2
and a molecular weight of 153.96 g/mol. Its IUPAC name is 2-iminoacetic acid;hydrobromide.
Molecular Properties
| Compound Name | 2-iminoacetic acid;hydrobromide |
| PubChem CID | 175483406 |
| Molecular Formula | C2H4BrNO2 |
| Molecular Weight | 153.96 g/mol |
| Exact Mass | 152.94 |
| IUPAC Name | 2-iminoacetic acid;hydrobromide |
| SMILES | Br.[H]/N=C/C(=O)O |
| InChI | InChI=1S/C2H3NO2.BrH/c3-1-2(4)5;/h1,3H,(H,4,5);1H/b3-1+; |
| InChIKey | BUGMSCYRGOKNIB-KSMVGCCESA-N |
| XLogP | 0.30 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.96 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iminoacetic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminoacetic acid;hydrobromide?
The IUPAC name of 2-iminoacetic acid;hydrobromide (CID 175483406) is 2-iminoacetic acid;hydrobromide.
What is the SMILES notation for 2-iminoacetic acid;hydrobromide?
The canonical SMILES for 2-iminoacetic acid;hydrobromide is Br.[H]/N=C/C(=O)O.
What is the InChIKey of 2-iminoacetic acid;hydrobromide?
The InChIKey is BUGMSCYRGOKNIB-KSMVGCCESA-N. The full InChI is InChI=1S/C2H3NO2.BrH/c3-1-2(4)5;/h1,3H,(H,4,5);1H/b3-1+;.
What are the key properties of 2-iminoacetic acid;hydrobromide?
2-iminoacetic acid;hydrobromide has a molecular weight of 153.96 g/mol, XLogP of 0.30, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminoacetic acid;hydrobromide is sourced from PubChem (CID 175483406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).