(E)-5-iminopent-2-enoic acid

C5H7NO2 — CID 166746904

IUPAC(E)-5-iminopent-2-enoic acid
SMILES[H]/N=C/C/C=C/C(=O)O
InChIInChI=1S/C5H7NO2/c6-4-2-1-3-5(7)8/h1,3-4,6H,2H2,(H,7,8)/b3-1+,6-4+
InChIKeyJSFDJVXDPRSMCV-ASPVKUGASA-N
MW113.12 g/mol
LogP0.67
Rot. Bonds3

About (E)-5-iminopent-2-enoic acid

(E)-5-iminopent-2-enoic acid (PubChem CID 166746904) has the molecular formula C5H7NO2 and a molecular weight of 113.12 g/mol. Its IUPAC name is (E)-5-iminopent-2-enoic acid.

Molecular Properties

Compound Name(E)-5-iminopent-2-enoic acid
PubChem CID166746904
Molecular FormulaC5H7NO2
Molecular Weight113.12 g/mol
Exact Mass113.05
IUPAC Name(E)-5-iminopent-2-enoic acid
SMILES[H]/N=C/C/C=C/C(=O)O
InChIInChI=1S/C5H7NO2/c6-4-2-1-3-5(7)8/h1,3-4,6H,2H2,(H,7,8)/b3-1+,6-4+
InChIKeyJSFDJVXDPRSMCV-ASPVKUGASA-N
XLogP0.67
TPSA61.15 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500113.12
LogP ≤ 50.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-5-iminopent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-5-iminopent-2-enoic acid?
The IUPAC name of (E)-5-iminopent-2-enoic acid (CID 166746904) is (E)-5-iminopent-2-enoic acid.
What is the SMILES notation for (E)-5-iminopent-2-enoic acid?
The canonical SMILES for (E)-5-iminopent-2-enoic acid is [H]/N=C/C/C=C/C(=O)O.
What is the InChIKey of (E)-5-iminopent-2-enoic acid?
The InChIKey is JSFDJVXDPRSMCV-ASPVKUGASA-N. The full InChI is InChI=1S/C5H7NO2/c6-4-2-1-3-5(7)8/h1,3-4,6H,2H2,(H,7,8)/b3-1+,6-4+.
What are the key properties of (E)-5-iminopent-2-enoic acid?
(E)-5-iminopent-2-enoic acid has a molecular weight of 113.12 g/mol, XLogP of 0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-iminopent-2-enoic acid is sourced from PubChem (CID 166746904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).