About acetic acid;(13C)methanimidamide
acetic acid;(13C)methanimidamide (PubChem CID 71309360) has the molecular formula C3H8N2O2
and a molecular weight of 107.09 g/mol. Its IUPAC name is acetic acid;(13C)methanimidamide.
Molecular Properties
| Compound Name | acetic acid;(13C)methanimidamide |
| PubChem CID | 71309360 |
| Molecular Formula | C3H8N2O2 |
| Molecular Weight | 107.09 g/mol |
| Exact Mass | 107.06 |
| IUPAC Name | acetic acid;(13C)methanimidamide |
| SMILES | CC(=O)O.[H]/[15N]=[13CH]/[15NH2] |
| InChI | InChI=1S/C2H4O2.CH4N2/c1-2(3)4;2-1-3/h1H3,(H,3,4);1H,(H3,2,3)/i;1+1,2+1,3+1 |
| InChIKey | XPOLVIIHTDKJRY-BURVIEGVSA-N |
| XLogP | -0.36 |
| TPSA | 87.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.09 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;(13C)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(13C)methanimidamide?
The IUPAC name of acetic acid;(13C)methanimidamide (CID 71309360) is acetic acid;(13C)methanimidamide.
What is the SMILES notation for acetic acid;(13C)methanimidamide?
The canonical SMILES for acetic acid;(13C)methanimidamide is CC(=O)O.[H]/[15N]=[13CH]/[15NH2].
What is the InChIKey of acetic acid;(13C)methanimidamide?
The InChIKey is XPOLVIIHTDKJRY-BURVIEGVSA-N. The full InChI is InChI=1S/C2H4O2.CH4N2/c1-2(3)4;2-1-3/h1H3,(H,3,4);1H,(H3,2,3)/i;1+1,2+1,3+1.
What are the key properties of acetic acid;(13C)methanimidamide?
acetic acid;(13C)methanimidamide has a molecular weight of 107.09 g/mol, XLogP of -0.36, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(13C)methanimidamide is sourced from PubChem (CID 71309360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).