hydrazine;methanimidamide;sulfuric acid

CH10N4O4S — CID 88809226

IUPAChydrazine;methanimidamide;sulfuric acid
SMILESNN.O=S(=O)(O)O.[H]/N=C/N
InChIInChI=1S/CH4N2.H4N2.H2O4S/c2-1-3;1-2;1-5(2,3)4/h1H,(H3,2,3);1-2H2;(H2,1,2,3,4)
InChIKeyRPFHNRMYRCYXHP-UHFFFAOYSA-N
MW174.18 g/mol
LogP-2.28
Rot. Bonds

About hydrazine;methanimidamide;sulfuric acid

hydrazine;methanimidamide;sulfuric acid (PubChem CID 88809226) has the molecular formula CH10N4O4S and a molecular weight of 174.18 g/mol. Its IUPAC name is hydrazine;methanimidamide;sulfuric acid.

Molecular Properties

Compound Namehydrazine;methanimidamide;sulfuric acid
PubChem CID88809226
Molecular FormulaCH10N4O4S
Molecular Weight174.18 g/mol
Exact Mass174.04
IUPAC Namehydrazine;methanimidamide;sulfuric acid
SMILESNN.O=S(=O)(O)O.[H]/N=C/N
InChIInChI=1S/CH4N2.H4N2.H2O4S/c2-1-3;1-2;1-5(2,3)4/h1H,(H3,2,3);1-2H2;(H2,1,2,3,4)
InChIKeyRPFHNRMYRCYXHP-UHFFFAOYSA-N
XLogP-2.28
TPSA176.51 Ų
H-Bond Donors6
H-Bond Acceptors5
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500174.18
LogP ≤ 5-2.28
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze hydrazine;methanimidamide;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrazine;methanimidamide;sulfuric acid?
The IUPAC name of hydrazine;methanimidamide;sulfuric acid (CID 88809226) is hydrazine;methanimidamide;sulfuric acid.
What is the SMILES notation for hydrazine;methanimidamide;sulfuric acid?
The canonical SMILES for hydrazine;methanimidamide;sulfuric acid is NN.O=S(=O)(O)O.[H]/N=C/N.
What is the InChIKey of hydrazine;methanimidamide;sulfuric acid?
The InChIKey is RPFHNRMYRCYXHP-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2.H4N2.H2O4S/c2-1-3;1-2;1-5(2,3)4/h1H,(H3,2,3);1-2H2;(H2,1,2,3,4).
What are the key properties of hydrazine;methanimidamide;sulfuric acid?
hydrazine;methanimidamide;sulfuric acid has a molecular weight of 174.18 g/mol, XLogP of -2.28, 0 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;methanimidamide;sulfuric acid is sourced from PubChem (CID 88809226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).