C5H8N2O6 — CID 159624533
(Z)-2,3-dihydroxybut-2-enedioic acid;methanimidamide (PubChem CID 159624533) has the molecular formula C5H8N2O6 and a molecular weight of 192.13 g/mol. Its IUPAC name is (Z)-2,3-dihydroxybut-2-enedioic acid;methanimidamide.
| Compound Name | (Z)-2,3-dihydroxybut-2-enedioic acid;methanimidamide |
|---|---|
| PubChem CID | 159624533 |
| Molecular Formula | C5H8N2O6 |
| Molecular Weight | 192.13 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | (Z)-2,3-dihydroxybut-2-enedioic acid;methanimidamide |
| SMILES | O=C(O)/C(O)=C(/O)C(=O)O.[H]/N=C/N |
| InChI | InChI=1S/C4H4O6.CH4N2/c5-1(3(7)8)2(6)4(9)10;2-1-3/h5-6H,(H,7,8)(H,9,10);1H,(H3,2,3)/b2-1-; |
| InChIKey | MOHWXQKECIQWMW-ODZAUARKSA-N |
| XLogP | -0.96 |
| TPSA | 164.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.13 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|