About acetamide;ethanimine;molecular hydrogen
acetamide;ethanimine;molecular hydrogen (PubChem CID 142839572) has the molecular formula C4H12N2O
and a molecular weight of 104.15 g/mol. Its IUPAC name is acetamide;ethanimine;molecular hydrogen.
Molecular Properties
| Compound Name | acetamide;ethanimine;molecular hydrogen |
| PubChem CID | 142839572 |
| Molecular Formula | C4H12N2O |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.09 |
| IUPAC Name | acetamide;ethanimine;molecular hydrogen |
| SMILES | CC(N)=O.[H]/N=C/C.[H][H] |
| InChI | InChI=1S/C2H5NO.C2H5N.H2/c1-2(3)4;1-2-3;/h1H3,(H2,3,4);2-3H,1H3;1H/b;3-2+; |
| InChIKey | TVVALWQFJXVSFR-VQSZBRBVSA-N |
| XLogP | 0.39 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze acetamide;ethanimine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;ethanimine;molecular hydrogen?
The IUPAC name of acetamide;ethanimine;molecular hydrogen (CID 142839572) is acetamide;ethanimine;molecular hydrogen.
What is the SMILES notation for acetamide;ethanimine;molecular hydrogen?
The canonical SMILES for acetamide;ethanimine;molecular hydrogen is CC(N)=O.[H]/N=C/C.[H][H].
What is the InChIKey of acetamide;ethanimine;molecular hydrogen?
The InChIKey is TVVALWQFJXVSFR-VQSZBRBVSA-N. The full InChI is InChI=1S/C2H5NO.C2H5N.H2/c1-2(3)4;1-2-3;/h1H3,(H2,3,4);2-3H,1H3;1H/b;3-2+;.
What are the key properties of acetamide;ethanimine;molecular hydrogen?
acetamide;ethanimine;molecular hydrogen has a molecular weight of 104.15 g/mol, XLogP of 0.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;ethanimine;molecular hydrogen is sourced from PubChem (CID 142839572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).