C10H17NO2 — CID 135746746
(E)-5-hydroxy-4-methanimidoyl-2,6-dimethylhept-4-en-3-one (PubChem CID 135746746) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (E)-5-hydroxy-4-methanimidoyl-2,6-dimethylhept-4-en-3-one.
| Compound Name | (E)-5-hydroxy-4-methanimidoyl-2,6-dimethylhept-4-en-3-one |
|---|---|
| PubChem CID | 135746746 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (E)-5-hydroxy-4-methanimidoyl-2,6-dimethylhept-4-en-3-one |
| SMILES | [H]/N=C/C(C(=O)C(C)C)=C(\O)C(C)C |
| InChI | InChI=1S/C10H17NO2/c1-6(2)9(12)8(5-11)10(13)7(3)4/h5-7,11-12H,1-4H3/b9-8+,11-5+ |
| InChIKey | KRWHDBACEUPNQF-SXGHKVHISA-N |
| XLogP | 2.33 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|