C10H16N2O2 — CID 173498344
4-amino-5-methanimidoyl-7-methyloct-4-ene-2,6-dione (PubChem CID 173498344) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-amino-5-methanimidoyl-7-methyloct-4-ene-2,6-dione.
| Compound Name | 4-amino-5-methanimidoyl-7-methyloct-4-ene-2,6-dione |
|---|---|
| PubChem CID | 173498344 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4-amino-5-methanimidoyl-7-methyloct-4-ene-2,6-dione |
| SMILES | [H]/N=C/C(C(=O)C(C)C)=C(N)CC(C)=O |
| InChI | InChI=1S/C10H16N2O2/c1-6(2)10(14)8(5-11)9(12)4-7(3)13/h5-6,11H,4,12H2,1-3H3/b9-8?,11-5+ |
| InChIKey | WCMAHZVNTIZHSP-IJIYPFQUSA-N |
| XLogP | 1.05 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|