C11H22N2 — CID 176949757
(Z)-3-methanimidoyl-2,2,6-trimethylhept-3-en-4-amine (PubChem CID 176949757) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (Z)-3-methanimidoyl-2,2,6-trimethylhept-3-en-4-amine.
| Compound Name | (Z)-3-methanimidoyl-2,2,6-trimethylhept-3-en-4-amine |
|---|---|
| PubChem CID | 176949757 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (Z)-3-methanimidoyl-2,2,6-trimethylhept-3-en-4-amine |
| SMILES | [H]/N=C/C(=C(\N)CC(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H22N2/c1-8(2)6-10(13)9(7-12)11(3,4)5/h7-8,12H,6,13H2,1-5H3/b10-9+,12-7+ |
| InChIKey | FKWAKRGMQCKUIH-YQDZKPHZSA-N |
| XLogP | 2.94 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|