C9H16N2 — CID 143255281
(2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine (PubChem CID 143255281) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine.
| Compound Name | (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine |
|---|---|
| PubChem CID | 143255281 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine |
| SMILES | [H]/N=C/C(=C/C)/C(N)=C\C(C)C |
| InChI | InChI=1S/C9H16N2/c1-4-8(6-10)9(11)5-7(2)3/h4-7,10H,11H2,1-3H3/b8-4-,9-5+,10-6+ |
| InChIKey | BEZCQSAUZGOQLB-JCLKPIFKSA-N |
| XLogP | 2.08 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|