About (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine
(2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine (PubChem CID 143255281) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine.
Molecular Properties
| Compound Name | (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine |
| PubChem CID | 143255281 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine |
| SMILES | [H]/N=C/C(=C/C)/C(N)=C\C(C)C |
| InChI | InChI=1S/C9H16N2/c1-4-8(6-10)9(11)5-7(2)3/h4-7,10H,11H2,1-3H3/b8-4-,9-5+,10-6+ |
| InChIKey | BEZCQSAUZGOQLB-JCLKPIFKSA-N |
| XLogP | 2.08 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine?
The IUPAC name of (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine (CID 143255281) is (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine.
What is the SMILES notation for (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine?
The canonical SMILES for (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine is [H]/N=C/C(=C/C)/C(N)=C\C(C)C.
What is the InChIKey of (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine?
The InChIKey is BEZCQSAUZGOQLB-JCLKPIFKSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-8(6-10)9(11)5-7(2)3/h4-7,10H,11H2,1-3H3/b8-4-,9-5+,10-6+.
What are the key properties of (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine?
(2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine has a molecular weight of 152.24 g/mol, XLogP of 2.08, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-3-methanimidoyl-6-methylhepta-2,4-dien-4-amine is sourced from PubChem (CID 143255281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).