C9H17N2+ — CID 145192802
[(1Z)-2-methanimidoyl-3-methylbuta-1,3-dienyl]-propan-2-ylazanium (PubChem CID 145192802) has the molecular formula C9H17N2+ and a molecular weight of 153.25 g/mol. Its IUPAC name is [(1Z)-2-methanimidoyl-3-methylbuta-1,3-dienyl]-propan-2-ylazanium.
| Compound Name | [(1Z)-2-methanimidoyl-3-methylbuta-1,3-dienyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 145192802 |
| Molecular Formula | C9H17N2+ |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.14 |
| IUPAC Name | [(1Z)-2-methanimidoyl-3-methylbuta-1,3-dienyl]-propan-2-ylazanium |
| SMILES | [H]/N=C/C(=C\[NH2+]C(C)C)C(=C)C |
| InChI | InChI=1S/C9H16N2/c1-7(2)9(5-10)6-11-8(3)4/h5-6,8,10-11H,1H2,2-4H3/p+1/b9-6+,10-5+ |
| InChIKey | OEIVURIICFFKGQ-TXFIJWAUSA-O |
| XLogP | 1.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|