C13H18N2S2 — CID 123329536
(Z)-2-[1-[[(Z)-2-(1-methylsulfanylethenyl)but-2-enylidene]amino]sulfanylethenyl]but-2-en-1-imine (PubChem CID 123329536) has the molecular formula C13H18N2S2 and a molecular weight of 266.44 g/mol. Its IUPAC name is (Z)-2-[1-[[(Z)-2-(1-methylsulfanylethenyl)but-2-enylidene]amino]sulfanylethenyl]but-2-en-1-imine.
| Compound Name | (Z)-2-[1-[[(Z)-2-(1-methylsulfanylethenyl)but-2-enylidene]amino]sulfanylethenyl]but-2-en-1-imine |
|---|---|
| PubChem CID | 123329536 |
| Molecular Formula | C13H18N2S2 |
| Molecular Weight | 266.44 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (Z)-2-[1-[[(Z)-2-(1-methylsulfanylethenyl)but-2-enylidene]amino]sulfanylethenyl]but-2-en-1-imine |
| SMILES | [H]/N=C/C(=C/C)C(=C)SN=C/C(=C/C)C(=C)SC |
| InChI | InChI=1S/C13H18N2S2/c1-6-12(8-14)11(4)17-15-9-13(7-2)10(3)16-5/h6-9,14H,3-4H2,1-2,5H3/b12-6-,13-7-,14-8+,15-9? |
| InChIKey | WCEYDBRFLLZYRE-SNBKPXAASA-N |
| XLogP | 4.64 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|