C8H10N2O — CID 156556155
(3E,5Z)-1-imino-3-methanimidoylhepta-3,5-dien-2-one (PubChem CID 156556155) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is (3E,5Z)-1-imino-3-methanimidoylhepta-3,5-dien-2-one.
| Compound Name | (3E,5Z)-1-imino-3-methanimidoylhepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 156556155 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (3E,5Z)-1-imino-3-methanimidoylhepta-3,5-dien-2-one |
| SMILES | [H]/N=C/C(=O)C(/C=N/[H])=C/C=C\C |
| InChI | InChI=1S/C8H10N2O/c1-2-3-4-7(5-9)8(11)6-10/h2-6,9-10H,1H3/b3-2-,7-4+,9-5+,10-6+ |
| InChIKey | YMOXOCQNTDUXFR-YMEFIDNKSA-N |
| XLogP | 1.36 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|