C7H10N2O — CID 122436508
(3Z,5Z)-3-diazenylhepta-3,5-dien-2-one (PubChem CID 122436508) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one.
| Compound Name | (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 122436508 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one |
| SMILES | [H]/N=N/C(=C\C=C/C)C(C)=O |
| InChI | InChI=1S/C7H10N2O/c1-3-4-5-7(9-8)6(2)10/h3-5,8H,1-2H3/b4-3-,7-5-,9-8+ |
| InChIKey | NHVGPBHRKRBCPE-LMHCHECESA-N |
| XLogP | 2.07 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|