About (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one
(3Z,5Z)-3-diazenylhepta-3,5-dien-2-one (PubChem CID 122436508) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one.
Molecular Properties
| Compound Name | (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one |
| PubChem CID | 122436508 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one |
| SMILES | [H]/N=N/C(=C\C=C/C)C(C)=O |
| InChI | InChI=1S/C7H10N2O/c1-3-4-5-7(9-8)6(2)10/h3-5,8H,1-2H3/b4-3-,7-5-,9-8+ |
| InChIKey | NHVGPBHRKRBCPE-LMHCHECESA-N |
| XLogP | 2.07 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one?
The IUPAC name of (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one (CID 122436508) is (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one.
What is the SMILES notation for (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one?
The canonical SMILES for (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one is [H]/N=N/C(=C\C=C/C)C(C)=O.
What is the InChIKey of (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one?
The InChIKey is NHVGPBHRKRBCPE-LMHCHECESA-N. The full InChI is InChI=1S/C7H10N2O/c1-3-4-5-7(9-8)6(2)10/h3-5,8H,1-2H3/b4-3-,7-5-,9-8+.
What are the key properties of (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one?
(3Z,5Z)-3-diazenylhepta-3,5-dien-2-one has a molecular weight of 138.17 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-3-diazenylhepta-3,5-dien-2-one is sourced from PubChem (CID 122436508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).