C10H15N3O2 — CID 89467841
N'-[(2E,4Z)-1-iminohexa-2,4-dien-2-yl]-N-methylpropanediamide (PubChem CID 89467841) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N'-[(2E,4Z)-1-iminohexa-2,4-dien-2-yl]-N-methylpropanediamide.
| Compound Name | N'-[(2E,4Z)-1-iminohexa-2,4-dien-2-yl]-N-methylpropanediamide |
|---|---|
| PubChem CID | 89467841 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N'-[(2E,4Z)-1-iminohexa-2,4-dien-2-yl]-N-methylpropanediamide |
| SMILES | [H]/N=C/C(=C\C=C/C)NC(=O)CC(=O)NC |
| InChI | InChI=1S/C10H15N3O2/c1-3-4-5-8(7-11)13-10(15)6-9(14)12-2/h3-5,7,11H,6H2,1-2H3,(H,12,14)(H,13,15)/b4-3-,8-5+,11-7+ |
| InChIKey | XBZUMRVQSMWGJE-JVFZCAIUSA-N |
| XLogP | 0.35 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|