About N'-ethyl-N-methylpropanediamide;methane
N'-ethyl-N-methylpropanediamide;methane (PubChem CID 158978281) has the molecular formula C10H28N2O2
and a molecular weight of 208.35 g/mol. Its IUPAC name is N'-ethyl-N-methylpropanediamide;methane.
Molecular Properties
| Compound Name | N'-ethyl-N-methylpropanediamide;methane |
| PubChem CID | 158978281 |
| Molecular Formula | C10H28N2O2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | N'-ethyl-N-methylpropanediamide;methane |
| SMILES | C.C.C.C.CCNC(=O)CC(=O)NC |
| InChI | InChI=1S/C6H12N2O2.4CH4/c1-3-8-6(10)4-5(9)7-2;;;;/h3-4H2,1-2H3,(H,7,9)(H,8,10);4*1H4 |
| InChIKey | JOQZNVGCTPBOQF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N-methylpropanediamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N-methylpropanediamide;methane?
The IUPAC name of N'-ethyl-N-methylpropanediamide;methane (CID 158978281) is N'-ethyl-N-methylpropanediamide;methane.
What is the SMILES notation for N'-ethyl-N-methylpropanediamide;methane?
The canonical SMILES for N'-ethyl-N-methylpropanediamide;methane is C.C.C.C.CCNC(=O)CC(=O)NC.
What is the InChIKey of N'-ethyl-N-methylpropanediamide;methane?
The InChIKey is JOQZNVGCTPBOQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2.4CH4/c1-3-8-6(10)4-5(9)7-2;;;;/h3-4H2,1-2H3,(H,7,9)(H,8,10);4*1H4.
What are the key properties of N'-ethyl-N-methylpropanediamide;methane?
N'-ethyl-N-methylpropanediamide;methane has a molecular weight of 208.35 g/mol, XLogP of 1.80, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N-methylpropanediamide;methane is sourced from PubChem (CID 158978281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).