C8H15NO — CID 143627282
(Z)-3-amino-2,5-dimethylhex-2-enal (PubChem CID 143627282) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (Z)-3-amino-2,5-dimethylhex-2-enal.
| Compound Name | (Z)-3-amino-2,5-dimethylhex-2-enal |
|---|---|
| PubChem CID | 143627282 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (Z)-3-amino-2,5-dimethylhex-2-enal |
| SMILES | C/C(C=O)=C(/N)CC(C)C |
| InChI | InChI=1S/C8H15NO/c1-6(2)4-8(9)7(3)5-10/h5-6H,4,9H2,1-3H3/b8-7- |
| InChIKey | CDYKBUYWBFGAPI-FPLPWBNLSA-N |
| XLogP | 1.46 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|