C8H13NO — CID 118527640
(2E,4Z)-5-amino-2,3-dimethylhexa-2,4-dienal (PubChem CID 118527640) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (2E,4Z)-5-amino-2,3-dimethylhexa-2,4-dienal.
| Compound Name | (2E,4Z)-5-amino-2,3-dimethylhexa-2,4-dienal |
|---|---|
| PubChem CID | 118527640 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (2E,4Z)-5-amino-2,3-dimethylhexa-2,4-dienal |
| SMILES | C/C(N)=C/C(C)=C(\C)C=O |
| InChI | InChI=1S/C8H13NO/c1-6(4-8(3)9)7(2)5-10/h4-5H,9H2,1-3H3/b7-6+,8-4- |
| InChIKey | ZCIJGJIGSCXAAE-SDMAFULYSA-N |
| XLogP | 1.38 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|