C7H12N2O — CID 74377910
2,6-diaminohepta-2,5-dien-4-one (PubChem CID 74377910) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 2,6-diaminohepta-2,5-dien-4-one.
| Compound Name | 2,6-diaminohepta-2,5-dien-4-one |
|---|---|
| PubChem CID | 74377910 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2,6-diaminohepta-2,5-dien-4-one |
| SMILES | CC(N)=CC(=O)C=C(C)N |
| InChI | InChI=1S/C7H12N2O/c1-5(8)3-7(10)4-6(2)9/h3-4H,8-9H2,1-2H3 |
| InChIKey | IRMAZJDXUCAMQK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|