About 2,6-diaminohepta-2,5-dien-4-one
2,6-diaminohepta-2,5-dien-4-one (PubChem CID 74377910) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 2,6-diaminohepta-2,5-dien-4-one.
Molecular Properties
| Compound Name | 2,6-diaminohepta-2,5-dien-4-one |
| PubChem CID | 74377910 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2,6-diaminohepta-2,5-dien-4-one |
| SMILES | CC(N)=CC(=O)C=C(C)N |
| InChI | InChI=1S/C7H12N2O/c1-5(8)3-7(10)4-6(2)9/h3-4H,8-9H2,1-2H3 |
| InChIKey | IRMAZJDXUCAMQK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diaminohepta-2,5-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diaminohepta-2,5-dien-4-one?
The IUPAC name of 2,6-diaminohepta-2,5-dien-4-one (CID 74377910) is 2,6-diaminohepta-2,5-dien-4-one.
What is the SMILES notation for 2,6-diaminohepta-2,5-dien-4-one?
The canonical SMILES for 2,6-diaminohepta-2,5-dien-4-one is CC(N)=CC(=O)C=C(C)N.
What is the InChIKey of 2,6-diaminohepta-2,5-dien-4-one?
The InChIKey is IRMAZJDXUCAMQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-5(8)3-7(10)4-6(2)9/h3-4H,8-9H2,1-2H3.
What are the key properties of 2,6-diaminohepta-2,5-dien-4-one?
2,6-diaminohepta-2,5-dien-4-one has a molecular weight of 140.19 g/mol, XLogP of 0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diaminohepta-2,5-dien-4-one is sourced from PubChem (CID 74377910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).