About (5Z)-2-amino-6-methylocta-2,5,7-trien-4-one
(5Z)-2-amino-6-methylocta-2,5,7-trien-4-one (PubChem CID 163530566) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is (5Z)-2-amino-6-methylocta-2,5,7-trien-4-one.
Molecular Properties
| Compound Name | (5Z)-2-amino-6-methylocta-2,5,7-trien-4-one |
| PubChem CID | 163530566 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (5Z)-2-amino-6-methylocta-2,5,7-trien-4-one |
| SMILES | C=C/C(C)=C\C(=O)C=C(C)N |
| InChI | InChI=1S/C9H13NO/c1-4-7(2)5-9(11)6-8(3)10/h4-6H,1,10H2,2-3H3/b7-5-,8-6? |
| InChIKey | UHKASBSEJLTLIM-WDFIMKRQSA-N |
| XLogP | 1.55 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-2-amino-6-methylocta-2,5,7-trien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-2-amino-6-methylocta-2,5,7-trien-4-one?
The IUPAC name of (5Z)-2-amino-6-methylocta-2,5,7-trien-4-one (CID 163530566) is (5Z)-2-amino-6-methylocta-2,5,7-trien-4-one.
What is the SMILES notation for (5Z)-2-amino-6-methylocta-2,5,7-trien-4-one?
The canonical SMILES for (5Z)-2-amino-6-methylocta-2,5,7-trien-4-one is C=C/C(C)=C\C(=O)C=C(C)N.
What is the InChIKey of (5Z)-2-amino-6-methylocta-2,5,7-trien-4-one?
The InChIKey is UHKASBSEJLTLIM-WDFIMKRQSA-N. The full InChI is InChI=1S/C9H13NO/c1-4-7(2)5-9(11)6-8(3)10/h4-6H,1,10H2,2-3H3/b7-5-,8-6?.
What are the key properties of (5Z)-2-amino-6-methylocta-2,5,7-trien-4-one?
(5Z)-2-amino-6-methylocta-2,5,7-trien-4-one has a molecular weight of 151.21 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-2-amino-6-methylocta-2,5,7-trien-4-one is sourced from PubChem (CID 163530566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).