C13H18O — CID 143377880
(3E,5E)-4,6-dimethyl-3-prop-1-en-2-ylocta-3,5,7-trien-2-one (PubChem CID 143377880) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (3E,5E)-4,6-dimethyl-3-prop-1-en-2-ylocta-3,5,7-trien-2-one.
| Compound Name | (3E,5E)-4,6-dimethyl-3-prop-1-en-2-ylocta-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 143377880 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (3E,5E)-4,6-dimethyl-3-prop-1-en-2-ylocta-3,5,7-trien-2-one |
| SMILES | C=C/C(C)=C/C(C)=C(\C(=C)C)C(C)=O |
| InChI | InChI=1S/C13H18O/c1-7-10(4)8-11(5)13(9(2)3)12(6)14/h7-8H,1-2H2,3-6H3/b10-8+,13-11+ |
| InChIKey | DKYPZEPEELFPMR-HATNNVTISA-N |
| XLogP | 3.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|