C13H18 — CID 170590567
3-ethenyl-2,5-dimethyl-4-prop-1-en-2-ylhexa-1,3,5-triene (PubChem CID 170590567) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 3-ethenyl-2,5-dimethyl-4-prop-1-en-2-ylhexa-1,3,5-triene.
| Compound Name | 3-ethenyl-2,5-dimethyl-4-prop-1-en-2-ylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 170590567 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 3-ethenyl-2,5-dimethyl-4-prop-1-en-2-ylhexa-1,3,5-triene |
| SMILES | C=CC(C(=C)C)=C(C(=C)C)C(=C)C |
| InChI | InChI=1S/C13H18/c1-8-12(9(2)3)13(10(4)5)11(6)7/h8H,1-2,4,6H2,3,5,7H3 |
| InChIKey | DVQNHHUOBSBZLO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|