C16H28 — CID 145061785
ethane;ethene;(3Z,5Z)-3-ethenyl-2,4-dimethylocta-1,3,5-triene (PubChem CID 145061785) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is ethane;ethene;(3Z,5Z)-3-ethenyl-2,4-dimethylocta-1,3,5-triene.
| Compound Name | ethane;ethene;(3Z,5Z)-3-ethenyl-2,4-dimethylocta-1,3,5-triene |
|---|---|
| PubChem CID | 145061785 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | ethane;ethene;(3Z,5Z)-3-ethenyl-2,4-dimethylocta-1,3,5-triene |
| SMILES | C=C.C=C/C(C(=C)C)=C(C)/C=C\CC.CC |
| InChI | InChI=1S/C12H18.C2H6.C2H4/c1-6-8-9-11(5)12(7-2)10(3)4;2*1-2/h7-9H,2-3,6H2,1,4-5H3;1-2H3;1-2H2/b9-8-,12-11-;; |
| InChIKey | CCSSENAHJDCTML-LTTUFRARSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|