C14H24 — CID 143840325
acetylene;ethane;(2Z,6Z)-5-methylidenenona-2,6-diene (PubChem CID 143840325) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is acetylene;ethane;(2Z,6Z)-5-methylidenenona-2,6-diene.
| Compound Name | acetylene;ethane;(2Z,6Z)-5-methylidenenona-2,6-diene |
|---|---|
| PubChem CID | 143840325 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | acetylene;ethane;(2Z,6Z)-5-methylidenenona-2,6-diene |
| SMILES | C#C.C=C(/C=C\CC)C/C=C\C.CC |
| InChI | InChI=1S/C10H16.C2H6.C2H2/c1-4-6-8-10(3)9-7-5-2;2*1-2/h4,6-7,9H,3,5,8H2,1-2H3;1-2H3;1-2H/b6-4-,9-7-;; |
| InChIKey | MQCDSUFWFKDOAA-XCWNNMAVSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|