C11H18 — CID 123418054
8-methylidenedeca-2,6-diene (PubChem CID 123418054) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is 8-methylidenedeca-2,6-diene.
| Compound Name | 8-methylidenedeca-2,6-diene |
|---|---|
| PubChem CID | 123418054 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 8-methylidenedeca-2,6-diene |
| SMILES | C=C(C=CCCC=CC)CC |
| InChI | InChI=1S/C11H18/c1-4-6-7-8-9-10-11(3)5-2/h4,6,9-10H,3,5,7-8H2,1-2H3 |
| InChIKey | FOFPSMTUPMCFKJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|