C12H20 — CID 57074948
5-methylideneundeca-2,6-diene (PubChem CID 57074948) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 5-methylideneundeca-2,6-diene.
| Compound Name | 5-methylideneundeca-2,6-diene |
|---|---|
| PubChem CID | 57074948 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 5-methylideneundeca-2,6-diene |
| SMILES | C=C(C=CCCCC)CC=CC |
| InChI | InChI=1S/C12H20/c1-4-6-8-9-11-12(3)10-7-5-2/h5,7,9,11H,3-4,6,8,10H2,1-2H3 |
| InChIKey | FQDVWJFSJYQPBH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|