C15H24 — CID 142378055
(2E,6E)-12-methyl-10-methylidenetrideca-2,6,11-triene (PubChem CID 142378055) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is (2E,6E)-12-methyl-10-methylidenetrideca-2,6,11-triene.
| Compound Name | (2E,6E)-12-methyl-10-methylidenetrideca-2,6,11-triene |
|---|---|
| PubChem CID | 142378055 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (2E,6E)-12-methyl-10-methylidenetrideca-2,6,11-triene |
| SMILES | C=C(C=C(C)C)CC/C=C/CC/C=C/C |
| InChI | InChI=1S/C15H24/c1-5-6-7-8-9-10-11-12-15(4)13-14(2)3/h5-6,9-10,13H,4,7-8,11-12H2,1-3H3/b6-5+,10-9+ |
| InChIKey | VIQCORSZMGARBS-QPHGKBKNSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|