C16H22O — CID 170006529
(3Z,5Z,9Z)-2-[(3Z)-penta-1,3-dien-2-yl]oxyundeca-1,3,5,9-tetraene (PubChem CID 170006529) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (3Z,5Z,9Z)-2-[(3Z)-penta-1,3-dien-2-yl]oxyundeca-1,3,5,9-tetraene.
| Compound Name | (3Z,5Z,9Z)-2-[(3Z)-penta-1,3-dien-2-yl]oxyundeca-1,3,5,9-tetraene |
|---|---|
| PubChem CID | 170006529 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (3Z,5Z,9Z)-2-[(3Z)-penta-1,3-dien-2-yl]oxyundeca-1,3,5,9-tetraene |
| SMILES | C=C(/C=C\C)OC(=C)/C=C\C=C/CC/C=C\C |
| InChI | InChI=1S/C16H22O/c1-5-7-8-9-10-11-12-14-16(4)17-15(3)13-6-2/h5-7,10-14H,3-4,8-9H2,1-2H3/b7-5-,11-10-,13-6-,14-12- |
| InChIKey | PWTXRKHQLFIUOZ-WOVAQNFESA-N |
| XLogP | 5.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|