C12H18O — CID 89135352
(3E,5E,9Z)-dodeca-1,3,5,9-tetraen-2-ol (PubChem CID 89135352) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (3E,5E,9Z)-dodeca-1,3,5,9-tetraen-2-ol.
| Compound Name | (3E,5E,9Z)-dodeca-1,3,5,9-tetraen-2-ol |
|---|---|
| PubChem CID | 89135352 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (3E,5E,9Z)-dodeca-1,3,5,9-tetraen-2-ol |
| SMILES | C=C(O)/C=C/C=C/CC/C=C\CC |
| InChI | InChI=1S/C12H18O/c1-3-4-5-6-7-8-9-10-11-12(2)13/h4-5,8-11,13H,2-3,6-7H2,1H3/b5-4-,9-8+,11-10+ |
| InChIKey | YIMULRFLXHOYSN-QYHQRLDKSA-N |
| XLogP | 3.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|