C12H17I — CID 89135344
(3E,5E,9Z)-2-iodododeca-1,3,5,9-tetraene (PubChem CID 89135344) has the molecular formula C12H17I and a molecular weight of 288.17 g/mol. Its IUPAC name is (3E,5E,9Z)-2-iodododeca-1,3,5,9-tetraene.
| Compound Name | (3E,5E,9Z)-2-iodododeca-1,3,5,9-tetraene |
|---|---|
| PubChem CID | 89135344 |
| Molecular Formula | C12H17I |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | (3E,5E,9Z)-2-iodododeca-1,3,5,9-tetraene |
| SMILES | C=C(I)/C=C/C=C/CC/C=C\CC |
| InChI | InChI=1S/C12H17I/c1-3-4-5-6-7-8-9-10-11-12(2)13/h4-5,8-11H,2-3,6-7H2,1H3/b5-4-,9-8+,11-10+ |
| InChIKey | ZBDSZGUERJGLOM-QYHQRLDKSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|