C10H13Cl — CID 139683602
(3E,5E)-4-chloro-3,6-dimethylocta-1,3,5,7-tetraene (PubChem CID 139683602) has the molecular formula C10H13Cl and a molecular weight of 168.67 g/mol. Its IUPAC name is (3E,5E)-4-chloro-3,6-dimethylocta-1,3,5,7-tetraene.
| Compound Name | (3E,5E)-4-chloro-3,6-dimethylocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 139683602 |
| Molecular Formula | C10H13Cl |
| Molecular Weight | 168.67 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | (3E,5E)-4-chloro-3,6-dimethylocta-1,3,5,7-tetraene |
| SMILES | C=C/C(C)=C/C(Cl)=C(/C)C=C |
| InChI | InChI=1S/C10H13Cl/c1-5-8(3)7-10(11)9(4)6-2/h5-7H,1-2H2,3-4H3/b8-7+,10-9+ |
| InChIKey | HBXCMXUJNRWIAG-XBLVEGMJSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|