C8H10OW — CID 59917037
[(4Z)-5-methyl-2-oxohepta-4,6-dien-3-ylidene]tungsten (PubChem CID 59917037) has the molecular formula C8H10OW and a molecular weight of 306.01 g/mol. Its IUPAC name is [(4Z)-5-methyl-2-oxohepta-4,6-dien-3-ylidene]tungsten.
| Compound Name | [(4Z)-5-methyl-2-oxohepta-4,6-dien-3-ylidene]tungsten |
|---|---|
| PubChem CID | 59917037 |
| Molecular Formula | C8H10OW |
| Molecular Weight | 306.01 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | [(4Z)-5-methyl-2-oxohepta-4,6-dien-3-ylidene]tungsten |
| SMILES | C=C/C(C)=C\C(=[W])C(C)=O |
| InChI | InChI=1S/C8H10O.W/c1-4-7(2)5-6-8(3)9;/h4-5H,1H2,2-3H3;/b7-5-; |
| InChIKey | SOVFRVUHLUJBNV-YJOCEBFMSA-N |
| XLogP | 1.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.01 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|