C7H13NO2 — CID 55285585
(Z,6R)-2-amino-6-hydroxyhept-2-en-4-one (PubChem CID 55285585) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (Z,6R)-2-amino-6-hydroxyhept-2-en-4-one.
| Compound Name | (Z,6R)-2-amino-6-hydroxyhept-2-en-4-one |
|---|---|
| PubChem CID | 55285585 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (Z,6R)-2-amino-6-hydroxyhept-2-en-4-one |
| SMILES | C/C(N)=C/C(=O)C[C@@H](C)O |
| InChI | InChI=1S/C7H13NO2/c1-5(8)3-7(10)4-6(2)9/h3,6,9H,4,8H2,1-2H3/b5-3-/t6-/m1/s1 |
| InChIKey | NOSGCRGLCDWLSU-CWVDAHFDSA-N |
| XLogP | 0.19 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|