C21H32N4O8 — CID 87744748
[3-[(Z)-3-aminobut-2-enoyl]oxy-2,2-bis[[(Z)-3-aminobut-2-enoyl]oxymethyl]propyl] (Z)-3-aminobut-2-enoate (PubChem CID 87744748) has the molecular formula C21H32N4O8 and a molecular weight of 468.51 g/mol. Its IUPAC name is [3-[(Z)-3-aminobut-2-enoyl]oxy-2,2-bis[[(Z)-3-aminobut-2-enoyl]oxymethyl]propyl] (Z)-3-aminobut-2-enoate.
| Compound Name | [3-[(Z)-3-aminobut-2-enoyl]oxy-2,2-bis[[(Z)-3-aminobut-2-enoyl]oxymethyl]propyl] (Z)-3-aminobut-2-enoate |
|---|---|
| PubChem CID | 87744748 |
| Molecular Formula | C21H32N4O8 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | [3-[(Z)-3-aminobut-2-enoyl]oxy-2,2-bis[[(Z)-3-aminobut-2-enoyl]oxymethyl]propyl] (Z)-3-aminobut-2-enoate |
| SMILES | C/C(N)=C/C(=O)OCC(COC(=O)/C=C(/C)N)(COC(=O)/C=C(/C)N)COC(=O)/C=C(/C)N |
| InChI | InChI=1S/C21H32N4O8/c1-13(22)5-17(26)30-9-21(10-31-18(27)6-14(2)23,11-32-19(28)7-15(3)24)12-33-20(29)8-16(4)25/h5-8H,9-12,22-25H2,1-4H3/b13-5-,14-6-,15-7-,16-8- |
| InChIKey | NLDBWHLHKJSWPU-XKDJMTFZSA-N |
| XLogP | -0.40 |
| TPSA | 209.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|