C17H20O8S4 — CID 141022171
[3-(3-sulfanylprop-2-enoyloxy)-2,2-bis(3-sulfanylprop-2-enoyloxymethyl)propyl] 3-sulfanylprop-2-enoate (PubChem CID 141022171) has the molecular formula C17H20O8S4 and a molecular weight of 480.61 g/mol. Its IUPAC name is [3-(3-sulfanylprop-2-enoyloxy)-2,2-bis(3-sulfanylprop-2-enoyloxymethyl)propyl] 3-sulfanylprop-2-enoate.
| Compound Name | [3-(3-sulfanylprop-2-enoyloxy)-2,2-bis(3-sulfanylprop-2-enoyloxymethyl)propyl] 3-sulfanylprop-2-enoate |
|---|---|
| PubChem CID | 141022171 |
| Molecular Formula | C17H20O8S4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | [3-(3-sulfanylprop-2-enoyloxy)-2,2-bis(3-sulfanylprop-2-enoyloxymethyl)propyl] 3-sulfanylprop-2-enoate |
| SMILES | O=C(C=CS)OCC(COC(=O)C=CS)(COC(=O)C=CS)COC(=O)C=CS |
| InChI | InChI=1S/C17H20O8S4/c18-13(1-5-26)22-9-17(10-23-14(19)2-6-27,11-24-15(20)3-7-28)12-25-16(21)4-8-29/h1-8,26-29H,9-12H2 |
| InChIKey | QXNJLJLPNIAWBW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|