C22H30O13 — CID 153433773
[3-[(E)-4-hydroxybut-2-enoyl]oxy-2,2-bis[[(E)-4-hydroxybut-2-enoyl]oxymethyl]propyl] (E)-4-hydroxy-2-(hydroxymethyl)but-2-enoate (PubChem CID 153433773) has the molecular formula C22H30O13 and a molecular weight of 502.47 g/mol. Its IUPAC name is [3-[(E)-4-hydroxybut-2-enoyl]oxy-2,2-bis[[(E)-4-hydroxybut-2-enoyl]oxymethyl]propyl] (E)-4-hydroxy-2-(hydroxymethyl)but-2-enoate.
| Compound Name | [3-[(E)-4-hydroxybut-2-enoyl]oxy-2,2-bis[[(E)-4-hydroxybut-2-enoyl]oxymethyl]propyl] (E)-4-hydroxy-2-(hydroxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 153433773 |
| Molecular Formula | C22H30O13 |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | [3-[(E)-4-hydroxybut-2-enoyl]oxy-2,2-bis[[(E)-4-hydroxybut-2-enoyl]oxymethyl]propyl] (E)-4-hydroxy-2-(hydroxymethyl)but-2-enoate |
| SMILES | O=C(/C=C/CO)OCC(COC(=O)/C=C/CO)(COC(=O)/C=C/CO)COC(=O)/C(=C/CO)CO |
| InChI | InChI=1S/C22H30O13/c23-8-1-4-18(28)32-13-22(14-33-19(29)5-2-9-24,15-34-20(30)6-3-10-25)16-35-21(31)17(12-27)7-11-26/h1-7,23-27H,8-16H2/b4-1+,5-2+,6-3+,17-7+ |
| InChIKey | XMCRDOYPLSTRHH-BOYPGDGKSA-N |
| XLogP | -2.30 |
| TPSA | 206.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|