C7H12N2O2 — CID 174311623
(5S)-5-amino-1-iminoheptane-2,6-dione (PubChem CID 174311623) has the molecular formula C7H12N2O2 and a molecular weight of 156.19 g/mol. Its IUPAC name is (5S)-5-amino-1-iminoheptane-2,6-dione.
| Compound Name | (5S)-5-amino-1-iminoheptane-2,6-dione |
|---|---|
| PubChem CID | 174311623 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (5S)-5-amino-1-iminoheptane-2,6-dione |
| SMILES | [H]/N=C/C(=O)CC[C@H](N)C(C)=O |
| InChI | InChI=1S/C7H12N2O2/c1-5(10)7(9)3-2-6(11)4-8/h4,7-8H,2-3,9H2,1H3/b8-4+/t7-/m0/s1 |
| InChIKey | HJZHYIZPWSMMIM-PUSOHNNWSA-N |
| XLogP | -0.10 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|