C8H11FmN2O4- — CID 166105970
fermium;methyl 6-imino-5-oxo-2-(oxomethylamino)hexanoate (PubChem CID 166105970) has the molecular formula C8H11FmN2O4- and a molecular weight of 456.19 g/mol. Its IUPAC name is fermium;methyl 6-imino-5-oxo-2-(oxomethylamino)hexanoate.
| Compound Name | fermium;methyl 6-imino-5-oxo-2-(oxomethylamino)hexanoate |
|---|---|
| PubChem CID | 166105970 |
| Molecular Formula | C8H11FmN2O4- |
| Molecular Weight | 456.19 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | fermium;methyl 6-imino-5-oxo-2-(oxomethylamino)hexanoate |
| SMILES | [Fm].[H]/N=C/C(=O)CCC(N[C-]=O)C(=O)OC |
| InChI | InChI=1S/C8H11N2O4.Fm/c1-14-8(13)7(10-5-11)3-2-6(12)4-9;/h4,7,9H,2-3H2,1H3,(H,10,11);/q-1;/b9-4+; |
| InChIKey | JCLNKKYDTLRMSM-JOKMOOFLSA-N |
| XLogP | -0.82 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.19 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|