C6H3F6NO2 — CID 135926805
(E)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-methanimidoylpent-3-en-2-one (PubChem CID 135926805) has the molecular formula C6H3F6NO2 and a molecular weight of 235.08 g/mol. Its IUPAC name is (E)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-methanimidoylpent-3-en-2-one.
| Compound Name | (E)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-methanimidoylpent-3-en-2-one |
|---|---|
| PubChem CID | 135926805 |
| Molecular Formula | C6H3F6NO2 |
| Molecular Weight | 235.08 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | (E)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-methanimidoylpent-3-en-2-one |
| SMILES | [H]/N=C/C(C(=O)C(F)(F)F)=C(\O)C(F)(F)F |
| InChI | InChI=1S/C6H3F6NO2/c7-5(8,9)3(14)2(1-13)4(15)6(10,11)12/h1,13-14H/b3-2+,13-1+ |
| InChIKey | GUVFORVHSUQVTC-FZGUVVAESA-N |
| XLogP | 2.14 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.08 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|