About (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea
(2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea (PubChem CID 137200138) has the molecular formula C7H7F3N2O3
and a molecular weight of 224.14 g/mol. Its IUPAC name is (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea.
Molecular Properties
| Compound Name | (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea |
| PubChem CID | 137200138 |
| Molecular Formula | C7H7F3N2O3 |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea |
| SMILES | CC(=O)C(C=NC(N)=O)=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H7F3N2O3/c1-3(13)4(2-12-6(11)15)5(14)7(8,9)10/h2,14H,1H3,(H2,11,15) |
| InChIKey | UUMLIMKXYADEBG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea?
The IUPAC name of (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea (CID 137200138) is (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea.
What is the SMILES notation for (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea?
The canonical SMILES for (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea is CC(=O)C(C=NC(N)=O)=C(O)C(F)(F)F.
What is the InChIKey of (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea?
The InChIKey is UUMLIMKXYADEBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2O3/c1-3(13)4(2-12-6(11)15)5(14)7(8,9)10/h2,14H,1H3,(H2,11,15).
What are the key properties of (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea?
(2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea has a molecular weight of 224.14 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea is sourced from PubChem (CID 137200138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).