C7H7F3N2O3 — CID 137200138
(2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea (PubChem CID 137200138) has the molecular formula C7H7F3N2O3 and a molecular weight of 224.14 g/mol. Its IUPAC name is (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea.
| Compound Name | (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea |
|---|---|
| PubChem CID | 137200138 |
| Molecular Formula | C7H7F3N2O3 |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (2-acetyl-4,4,4-trifluoro-3-hydroxybut-2-enylidene)urea |
| SMILES | CC(=O)C(C=NC(N)=O)=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H7F3N2O3/c1-3(13)4(2-12-6(11)15)5(14)7(8,9)10/h2,14H,1H3,(H2,11,15) |
| InChIKey | UUMLIMKXYADEBG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|