C6H4F6O2 — CID 134899533
(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-methylpent-3-en-2-one (PubChem CID 134899533) has the molecular formula C6H4F6O2 and a molecular weight of 222.08 g/mol. Its IUPAC name is (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-methylpent-3-en-2-one.
| Compound Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-methylpent-3-en-2-one |
|---|---|
| PubChem CID | 134899533 |
| Molecular Formula | C6H4F6O2 |
| Molecular Weight | 222.08 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxy-3-methylpent-3-en-2-one |
| SMILES | C/C(C(=O)C(F)(F)F)=C(/O)C(F)(F)F |
| InChI | InChI=1S/C6H4F6O2/c1-2(3(13)5(7,8)9)4(14)6(10,11)12/h13H,1H3/b3-2- |
| InChIKey | KRHWIUCTCZMZDK-IHWYPQMZSA-N |
| XLogP | 2.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.08 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|