About ethylideneurea;sulfurous acid
ethylideneurea;sulfurous acid (PubChem CID 174973219) has the molecular formula C3H8N2O4S
and a molecular weight of 168.17 g/mol. Its IUPAC name is ethylideneurea;sulfurous acid.
Molecular Properties
| Compound Name | ethylideneurea;sulfurous acid |
| PubChem CID | 174973219 |
| Molecular Formula | C3H8N2O4S |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | ethylideneurea;sulfurous acid |
| SMILES | CC=NC(N)=O.O=S(O)O |
| InChI | InChI=1S/C3H6N2O.H2O3S/c1-2-5-3(4)6;1-4(2)3/h2H,1H3,(H2,4,6);(H2,1,2,3) |
| InChIKey | XBKGBEMCIIOBQF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze ethylideneurea;sulfurous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylideneurea;sulfurous acid?
The IUPAC name of ethylideneurea;sulfurous acid (CID 174973219) is ethylideneurea;sulfurous acid.
What is the SMILES notation for ethylideneurea;sulfurous acid?
The canonical SMILES for ethylideneurea;sulfurous acid is CC=NC(N)=O.O=S(O)O.
What is the InChIKey of ethylideneurea;sulfurous acid?
The InChIKey is XBKGBEMCIIOBQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O.H2O3S/c1-2-5-3(4)6;1-4(2)3/h2H,1H3,(H2,4,6);(H2,1,2,3).
What are the key properties of ethylideneurea;sulfurous acid?
ethylideneurea;sulfurous acid has a molecular weight of 168.17 g/mol, XLogP of -0.16, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethylideneurea;sulfurous acid is sourced from PubChem (CID 174973219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).